C20H18N4O3 — CID 171969462
benzyl 7-(2-cyanopyrimidin-5-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171969462) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is benzyl 7-(2-cyanopyrimidin-5-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-(2-cyanopyrimidin-5-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969462 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | benzyl 7-(2-cyanopyrimidin-5-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | N#Cc1ncc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H18N4O3/c21-8-19-22-9-16(10-23-19)15-6-17-12-26-13-18(7-15)24(17)20(25)27-11-14-4-2-1-3-5-14/h1-6,9-10,17-18H,7,11-13H2 |
| InChIKey | KIWNQXUCSQOBLB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |