About 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide
3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide (PubChem CID 171972742) has the molecular formula C15H12F6OS
and a molecular weight of 354.32 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide |
| PubChem CID | 171972742 |
| Molecular Formula | C15H12F6OS |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide |
| SMILES | O=S1C2C=C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC1CC2 |
| InChI | InChI=1S/C15H12F6OS/c16-14(17,18)10-3-8(4-11(7-10)15(19,20)21)9-5-12-1-2-13(6-9)23(12)22/h3-5,7,12-13H,1-2,6H2 |
| InChIKey | SLSGZZZVHWVMHE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide (CID 171972742) is 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide is O=S1C2C=C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC1CC2.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
The InChIKey is SLSGZZZVHWVMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F6OS/c16-14(17,18)10-3-8(4-11(7-10)15(19,20)21)9-5-12-1-2-13(6-9)23(12)22/h3-5,7,12-13H,1-2,6H2.
What are the key properties of 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide has a molecular weight of 354.32 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)phenyl]-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide is sourced from PubChem (CID 171972742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).