About 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide
3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (PubChem CID 171974124) has the molecular formula C16H17F3OS
and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
Molecular Properties
| Compound Name | 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| PubChem CID | 171974124 |
| Molecular Formula | C16H17F3OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| SMILES | Cc1ccc(C(F)(F)F)cc1C1=CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C16H17F3OS/c1-10-5-6-12(16(17,18)19)9-15(10)11-7-13-3-2-4-14(8-11)21(13)20/h5-7,9,13-14H,2-4,8H2,1H3 |
| InChIKey | ZAUTVSZCZSGKPQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The IUPAC name of 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (CID 171974124) is 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
What is the SMILES notation for 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The canonical SMILES for 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide is Cc1ccc(C(F)(F)F)cc1C1=CC2CCCC(C1)S2=O.
What is the InChIKey of 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
The InChIKey is ZAUTVSZCZSGKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3OS/c1-10-5-6-12(16(17,18)19)9-15(10)11-7-13-3-2-4-14(8-11)21(13)20/h5-7,9,13-14H,2-4,8H2,1H3.
What are the key properties of 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide?
3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide has a molecular weight of 314.37 g/mol, XLogP of 4.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methyl-5-(trifluoromethyl)phenyl]-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide is sourced from PubChem (CID 171974124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).