C20H11F6N3O3 — CID 172517336
1-[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one (PubChem CID 172517336) has the molecular formula C20H11F6N3O3 and a molecular weight of 455.31 g/mol. Its IUPAC name is 1-[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one.
| Compound Name | 1-[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one |
|---|---|
| PubChem CID | 172517336 |
| Molecular Formula | C20H11F6N3O3 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 1-[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one |
| SMILES | O=C1CN1c1cc(N2CC2=O)c(N2CC2=O)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H11F6N3O3/c21-19(22,23)10-1-9(2-11(3-10)20(24,25)26)12-4-14(28-7-17(28)31)15(29-8-18(29)32)5-13(12)27-6-16(27)30/h1-5H,6-8H2 |
| InChIKey | KHDRCEISFCZPBO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|