C17H29NO4 — CID 171973134
tert-butyl 7-(4-methoxybutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171973134) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is tert-butyl 7-(4-methoxybutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | tert-butyl 7-(4-methoxybutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171973134 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | tert-butyl 7-(4-methoxybutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | COCCCCC1=CC2COCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO4/c1-17(2,3)22-16(19)18-14-9-13(7-5-6-8-20-4)10-15(18)12-21-11-14/h9,14-15H,5-8,10-12H2,1-4H3 |
| InChIKey | PPPYLNLLKBWEOM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|