C16H26FNO3 — CID 171974260
tert-butyl 7-(4-fluorobutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171974260) has the molecular formula C16H26FNO3 and a molecular weight of 299.39 g/mol. Its IUPAC name is tert-butyl 7-(4-fluorobutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | tert-butyl 7-(4-fluorobutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171974260 |
| Molecular Formula | C16H26FNO3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | tert-butyl 7-(4-fluorobutyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(CCCCF)CC1COC2 |
| InChI | InChI=1S/C16H26FNO3/c1-16(2,3)21-15(19)18-13-8-12(6-4-5-7-17)9-14(18)11-20-10-13/h8,13-14H,4-7,9-11H2,1-3H3 |
| InChIKey | DIFYCGFLNDZBCJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|