C16H17F3O2S — CID 171973710
3-[[4-(trifluoromethyl)phenyl]methyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171973710) has the molecular formula C16H17F3O2S and a molecular weight of 330.37 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)phenyl]methyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
| Compound Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
|---|---|
| PubChem CID | 171973710 |
| Molecular Formula | C16H17F3O2S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | O=S1(=O)C2C=C(Cc3ccc(C(F)(F)F)cc3)CC1CCC2 |
| InChI | InChI=1S/C16H17F3O2S/c17-16(18,19)13-6-4-11(5-7-13)8-12-9-14-2-1-3-15(10-12)22(14,20)21/h4-7,9,14-15H,1-3,8,10H2 |
| InChIKey | MIMUQNBABUSZFT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|