About 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide
3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide (PubChem CID 171973645) has the molecular formula C15H15F3O3S
and a molecular weight of 332.34 g/mol. Its IUPAC name is 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide.
Molecular Properties
| Compound Name | 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
| PubChem CID | 171973645 |
| Molecular Formula | C15H15F3O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
| SMILES | COc1cc(C(F)(F)F)ccc1C1=CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C15H15F3O3S/c1-21-14-8-10(15(16,17)18)2-5-13(14)9-6-11-3-4-12(7-9)22(11,19)20/h2,5-6,8,11-12H,3-4,7H2,1H3 |
| InChIKey | ZXJHDCAAYJBNEI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide?
The IUPAC name of 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide (CID 171973645) is 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide.
What is the SMILES notation for 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide?
The canonical SMILES for 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide is COc1cc(C(F)(F)F)ccc1C1=CC2CCC(C1)S2(=O)=O.
What is the InChIKey of 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide?
The InChIKey is ZXJHDCAAYJBNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3O3S/c1-21-14-8-10(15(16,17)18)2-5-13(14)9-6-11-3-4-12(7-9)22(11,19)20/h2,5-6,8,11-12H,3-4,7H2,1H3.
What are the key properties of 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide?
3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide has a molecular weight of 332.34 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methoxy-4-(trifluoromethyl)phenyl]-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide is sourced from PubChem (CID 171973645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).