C22H13N3O2 — CID 171978500
[(Z)-indeno[1,2-b]quinoxalin-11-ylideneamino] benzoate (PubChem CID 171978500) has the molecular formula C22H13N3O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is [(Z)-indeno[1,2-b]quinoxalin-11-ylideneamino] benzoate.
| Compound Name | [(Z)-indeno[1,2-b]quinoxalin-11-ylideneamino] benzoate |
|---|---|
| PubChem CID | 171978500 |
| Molecular Formula | C22H13N3O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [(Z)-indeno[1,2-b]quinoxalin-11-ylideneamino] benzoate |
| SMILES | O=C(O/N=C1/c2ccccc2-c2nc3ccccc3nc21)c1ccccc1 |
| InChI | InChI=1S/C22H13N3O2/c26-22(14-8-2-1-3-9-14)27-25-20-16-11-5-4-10-15(16)19-21(20)24-18-13-7-6-12-17(18)23-19/h1-13H/b25-20- |
| InChIKey | OLMJHJKAFXXBRZ-QQTULTPQSA-N |
| XLogP | 4.22 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|