C15H13N2O2+ — CID 171984010
3-(3-methoxyphenyl)-2H-pyrido[1,2-a]pyrazin-5-ium-1-one (PubChem CID 171984010) has the molecular formula C15H13N2O2+ and a molecular weight of 253.28 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2H-pyrido[1,2-a]pyrazin-5-ium-1-one.
| Compound Name | 3-(3-methoxyphenyl)-2H-pyrido[1,2-a]pyrazin-5-ium-1-one |
|---|---|
| PubChem CID | 171984010 |
| Molecular Formula | C15H13N2O2+ |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-(3-methoxyphenyl)-2H-pyrido[1,2-a]pyrazin-5-ium-1-one |
| SMILES | COc1cccc(-c2c[n+]3ccccc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C15H12N2O2/c1-19-12-6-4-5-11(9-12)13-10-17-8-3-2-7-14(17)15(18)16-13/h2-10H,1H3/p+1 |
| InChIKey | DVUADCCVNZSFFJ-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 46.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|