C14H14N3O2+ — CID 89414063
6-(3-methoxyphenyl)-2-methyl-7H-imidazo[1,5-a]pyrazin-2-ium-8-one (PubChem CID 89414063) has the molecular formula C14H14N3O2+ and a molecular weight of 256.28 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-2-methyl-7H-imidazo[1,5-a]pyrazin-2-ium-8-one.
| Compound Name | 6-(3-methoxyphenyl)-2-methyl-7H-imidazo[1,5-a]pyrazin-2-ium-8-one |
|---|---|
| PubChem CID | 89414063 |
| Molecular Formula | C14H14N3O2+ |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 6-(3-methoxyphenyl)-2-methyl-7H-imidazo[1,5-a]pyrazin-2-ium-8-one |
| SMILES | COc1cccc(-c2cn3c[n+](C)cc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H13N3O2/c1-16-8-13-14(18)15-12(7-17(13)9-16)10-4-3-5-11(6-10)19-2/h3-9H,1-2H3/p+1 |
| InChIKey | JPJGDIXSHWDTDP-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|