C18H19N3OS2 — CID 171987366
11,11-dimethyl-4-(phenylsulfanylmethyl)-12-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine (PubChem CID 171987366) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 11,11-dimethyl-4-(phenylsulfanylmethyl)-12-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine.
| Compound Name | 11,11-dimethyl-4-(phenylsulfanylmethyl)-12-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine |
|---|---|
| PubChem CID | 171987366 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 11,11-dimethyl-4-(phenylsulfanylmethyl)-12-oxa-8-thia-3,5-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine |
| SMILES | CC1(C)Cc2sc3c(N)nc(CSc4ccccc4)nc3c2CO1 |
| InChI | InChI=1S/C18H19N3OS2/c1-18(2)8-13-12(9-22-18)15-16(24-13)17(19)21-14(20-15)10-23-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | ADYAWRQQVJGVRV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |