C20H19N5OS — CID 23936168
(4,4-dimethyl-8-phenyl-5-oxa-17-thia-9,13,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11,13,15-hexaen-12-yl)hydrazine (PubChem CID 23936168) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is (4,4-dimethyl-8-phenyl-5-oxa-17-thia-9,13,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11,13,15-hexaen-12-yl)hydrazine.
| Compound Name | (4,4-dimethyl-8-phenyl-5-oxa-17-thia-9,13,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11,13,15-hexaen-12-yl)hydrazine |
|---|---|
| PubChem CID | 23936168 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (4,4-dimethyl-8-phenyl-5-oxa-17-thia-9,13,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11,13,15-hexaen-12-yl)hydrazine |
| SMILES | CC1(C)Cc2c(c(-c3ccccc3)nc3c2sc2ncnc(NN)c23)CO1 |
| InChI | InChI=1S/C20H19N5OS/c1-20(2)8-12-13(9-26-20)15(11-6-4-3-5-7-11)24-16-14-18(25-21)22-10-23-19(14)27-17(12)16/h3-7,10H,8-9,21H2,1-2H3,(H,22,23,25) |
| InChIKey | HDQCPVDPYPEEND-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|