About [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine
[2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83200763) has the molecular formula C13H14N4S2
and a molecular weight of 290.42 g/mol. Its IUPAC name is [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| PubChem CID | 83200763 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(CSc2ccccc2)nc2c1CSC2 |
| InChI | InChI=1S/C13H14N4S2/c14-17-13-10-6-18-7-11(10)15-12(16-13)8-19-9-4-2-1-3-5-9/h1-5H,6-8,14H2,(H,15,16,17) |
| InChIKey | SXOMFUJBVXMQMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (CID 83200763) is [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine is NNc1nc(CSc2ccccc2)nc2c1CSC2.
What is the InChIKey of [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The InChIKey is SXOMFUJBVXMQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4S2/c14-17-13-10-6-18-7-11(10)15-12(16-13)8-19-9-4-2-1-3-5-9/h1-5H,6-8,14H2,(H,15,16,17).
What are the key properties of [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
[2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine has a molecular weight of 290.42 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(phenylsulfanylmethyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 83200763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).