C16H14N2O5 — CID 17199887
(E)-4-[3-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 17199887) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is (E)-4-[3-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 17199887 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-4-[3-(furan-2-ylmethylcarbamoyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C16H14N2O5/c19-14(6-7-15(20)21)18-12-4-1-3-11(9-12)16(22)17-10-13-5-2-8-23-13/h1-9H,10H2,(H,17,22)(H,18,19)(H,20,21)/b7-6+ |
| InChIKey | NFZLTEYWFDGIOT-VOTSOKGWSA-N |
| XLogP | 1.79 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|