C11H12N2O2S — CID 17217748
N-(1,2-oxazol-3-yl)-5-propylthiophene-3-carboxamide (PubChem CID 17217748) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-5-propylthiophene-3-carboxamide.
| Compound Name | N-(1,2-oxazol-3-yl)-5-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17217748 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-5-propylthiophene-3-carboxamide |
| SMILES | CCCc1cc(C(=O)Nc2ccon2)cs1 |
| InChI | InChI=1S/C11H12N2O2S/c1-2-3-9-6-8(7-16-9)11(14)12-10-4-5-15-13-10/h4-7H,2-3H2,1H3,(H,12,13,14) |
| InChIKey | CPBSLJUHEZSHAV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |