C10H10N2O2S — CID 17217746
5-ethyl-N-(1,2-oxazol-3-yl)thiophene-2-carboxamide (PubChem CID 17217746) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 5-ethyl-N-(1,2-oxazol-3-yl)thiophene-2-carboxamide.
| Compound Name | 5-ethyl-N-(1,2-oxazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17217746 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-ethyl-N-(1,2-oxazol-3-yl)thiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccon2)s1 |
| InChI | InChI=1S/C10H10N2O2S/c1-2-7-3-4-8(15-7)10(13)11-9-5-6-14-12-9/h3-6H,2H2,1H3,(H,11,12,13) |
| InChIKey | NYJRLHWRQODXNA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |