C21H22Br2N2O5 — CID 17222513
N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-4-(oxolan-2-ylmethoxy)benzohydrazide (PubChem CID 17222513) has the molecular formula C21H22Br2N2O5 and a molecular weight of 542.22 g/mol. Its IUPAC name is N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-4-(oxolan-2-ylmethoxy)benzohydrazide.
| Compound Name | N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-4-(oxolan-2-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17222513 |
| Molecular Formula | C21H22Br2N2O5 |
| Molecular Weight | 542.22 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-4-(oxolan-2-ylmethoxy)benzohydrazide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NNC(=O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H22Br2N2O5/c1-13-9-15(22)10-18(23)20(13)30-12-19(26)24-25-21(27)14-4-6-16(7-5-14)29-11-17-3-2-8-28-17/h4-7,9-10,17H,2-3,8,11-12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | OEUXPOJISMOCDF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|