C32H20N2O10S — CID 172500707
[4-[4-(2-methyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]sulfonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 172500707) has the molecular formula C32H20N2O10S and a molecular weight of 624.58 g/mol. Its IUPAC name is [4-[4-(2-methyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]sulfonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[4-(2-methyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]sulfonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 172500707 |
| Molecular Formula | C32H20N2O10S |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | [4-[4-(2-methyl-1,3-dioxoisoindole-5-carbonyl)oxyphenyl]sulfonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CN1C(=O)c2ccc(C(=O)Oc3ccc(S(=O)(=O)c4ccc(OC(=O)c5ccc6c(c5)C(=O)N(C)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C32H20N2O10S/c1-33-27(35)23-13-3-17(15-25(23)29(33)37)31(39)43-19-5-9-21(10-6-19)45(41,42)22-11-7-20(8-12-22)44-32(40)18-4-14-24-26(16-18)30(38)34(2)28(24)36/h3-16H,1-2H3 |
| InChIKey | RCIRLTPXLZRJNZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|