C33H50N2O3 — CID 172515445
[(9Z,12Z)-octadeca-9,12-dienyl] (2R)-2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 172515445) has the molecular formula C33H50N2O3 and a molecular weight of 522.77 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] (2R)-2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] (2R)-2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172515445 |
| Molecular Formula | C33H50N2O3 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] (2R)-2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)N1CCC[C@@H]1Cc1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C33H50N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-38-33(36)35-23-19-20-29(35)25-28-27-34-32-22-21-30(37-2)26-31(28)32/h7-8,10-11,21-22,26-27,29,34H,3-6,9,12-20,23-25H2,1-2H3/b8-7-,11-10-/t29-/m1/s1 |
| InChIKey | MPELHVLNGIOTOL-LQJXZILHSA-N |
| XLogP | 9.13 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|