C33H49NO5S — CID 172517935
2-[benzyl-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid (PubChem CID 172517935) has the molecular formula C33H49NO5S and a molecular weight of 571.82 g/mol. Its IUPAC name is 2-[benzyl-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[benzyl-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 172517935 |
| Molecular Formula | C33H49NO5S |
| Molecular Weight | 571.82 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | 2-[benzyl-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](CCC(=O)N(CCS(=O)(=O)O)Cc1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H49NO5S/c1-23(9-14-31(36)34(19-20-40(37,38)39)22-24-7-5-4-6-8-24)28-12-13-29-27-11-10-25-21-26(35)15-17-32(25,2)30(27)16-18-33(28,29)3/h4-8,23,25,27-30H,9-22H2,1-3H3,(H,37,38,39)/t23-,25-,27+,28-,29+,30+,32+,33-/m1/s1 |
| InChIKey | ZHUPSZAYAXCARP-WKGVMIBLSA-N |
| XLogP | 6.55 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.82 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|