C34H51NO15 — CID 172518119
tert-butyl 3-[(3S,4R,5R,6R)-4,5-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-6-[(4-nitrophenoxy)carbonyloxymethyl]oxan-3-yl]oxypropanoate (PubChem CID 172518119) has the molecular formula C34H51NO15 and a molecular weight of 713.77 g/mol. Its IUPAC name is tert-butyl 3-[(3S,4R,5R,6R)-4,5-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-6-[(4-nitrophenoxy)carbonyloxymethyl]oxan-3-yl]oxypropanoate.
| Compound Name | tert-butyl 3-[(3S,4R,5R,6R)-4,5-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-6-[(4-nitrophenoxy)carbonyloxymethyl]oxan-3-yl]oxypropanoate |
|---|---|
| PubChem CID | 172518119 |
| Molecular Formula | C34H51NO15 |
| Molecular Weight | 713.77 g/mol |
| Exact Mass | 713.33 |
| IUPAC Name | tert-butyl 3-[(3S,4R,5R,6R)-4,5-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-6-[(4-nitrophenoxy)carbonyloxymethyl]oxan-3-yl]oxypropanoate |
| SMILES | CC(C)(C)OC(=O)CCO[C@H]1[C@H](OCCC(=O)OC(C)(C)C)[C@@H](COC(=O)Oc2ccc([N+](=O)[O-])cc2)OC[C@@H]1OCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H51NO15/c1-32(2,3)48-26(36)14-17-42-24-20-45-25(21-46-31(39)47-23-12-10-22(11-13-23)35(40)41)30(44-19-16-28(38)50-34(7,8)9)29(24)43-18-15-27(37)49-33(4,5)6/h10-13,24-25,29-30H,14-21H2,1-9H3/t24-,25+,29+,30+/m0/s1 |
| InChIKey | UQWXKEOEYROMHC-NLCQSSBISA-N |
| XLogP | 4.86 |
| TPSA | 194.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|