C24H16BrN — CID 172519786
2-bromo-1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-phenylcarbazole (PubChem CID 172519786) has the molecular formula C24H16BrN and a molecular weight of 409.37 g/mol. Its IUPAC name is 2-bromo-1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-phenylcarbazole.
| Compound Name | 2-bromo-1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-phenylcarbazole |
|---|---|
| PubChem CID | 172519786 |
| Molecular Formula | C24H16BrN |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-bromo-1,3,4,5,6,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c(Br)c([2H])c([2H])c3c3c([2H])c([2H])c(-c4ccccc4)c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C24H16BrN/c25-19-12-14-22-21-13-11-18(17-7-3-1-4-8-17)15-23(21)26(24(22)16-19)20-9-5-2-6-10-20/h1-16H/i2D,5D,6D,9D,10D,11D,12D,13D,14D,15D,16D |
| InChIKey | ZRWIRHYLHIQKSD-KMBMLZHQSA-N |
| XLogP | 7.21 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |