C18H11Br2N — CID 59500390
2,7-dibromo-1,3,4,5,6,8-hexadeuterio-9-phenylcarbazole (PubChem CID 59500390) has the molecular formula C18H11Br2N and a molecular weight of 407.14 g/mol. Its IUPAC name is 2,7-dibromo-1,3,4,5,6,8-hexadeuterio-9-phenylcarbazole.
| Compound Name | 2,7-dibromo-1,3,4,5,6,8-hexadeuterio-9-phenylcarbazole |
|---|---|
| PubChem CID | 59500390 |
| Molecular Formula | C18H11Br2N |
| Molecular Weight | 407.14 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | 2,7-dibromo-1,3,4,5,6,8-hexadeuterio-9-phenylcarbazole |
| SMILES | [2H]c1c(Br)c([2H])c2c(c1[2H])c1c([2H])c([2H])c(Br)c([2H])c1n2-c1ccccc1 |
| InChI | InChI=1S/C18H11Br2N/c19-12-6-8-15-16-9-7-13(20)11-18(16)21(17(15)10-12)14-4-2-1-3-5-14/h1-11H/i6D,7D,8D,9D,10D,11D |
| InChIKey | MDXCDMSVFQIDGN-WJTQYTSOSA-N |
| XLogP | 6.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.14 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |