C19H16ClN5O2 — CID 172521045
6-chloro-3-[[(1R)-1-(2-cyano-3,7-dimethylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid (PubChem CID 172521045) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-(2-cyano-3,7-dimethylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[[(1R)-1-(2-cyano-3,7-dimethylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 172521045 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-(2-cyano-3,7-dimethylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(=O)O)c2nc(C)c(C#N)nc2c1 |
| InChI | InChI=1S/C19H16ClN5O2/c1-9-6-12(17-14(7-9)24-15(8-21)11(3)23-17)10(2)22-13-4-5-16(20)25-18(13)19(26)27/h4-7,10,22H,1-3H3,(H,26,27)/t10-/m1/s1 |
| InChIKey | AQNJIRGKORXTEH-SNVBAGLBSA-N |
| XLogP | 4.04 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|