C22H20ClN5O3 — CID 172522048
6-chloro-3-[[(1R)-1-[2-cyano-7-methyl-3-[(3R)-oxolan-3-yl]quinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid (PubChem CID 172522048) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[2-cyano-7-methyl-3-[(3R)-oxolan-3-yl]quinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[[(1R)-1-[2-cyano-7-methyl-3-[(3R)-oxolan-3-yl]quinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 172522048 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[2-cyano-7-methyl-3-[(3R)-oxolan-3-yl]quinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(=O)O)c2nc([C@H]3CCOC3)c(C#N)nc2c1 |
| InChI | InChI=1S/C22H20ClN5O3/c1-11-7-14(12(2)25-15-3-4-18(23)27-21(15)22(29)30)20-16(8-11)26-17(9-24)19(28-20)13-5-6-31-10-13/h3-4,7-8,12-13,25H,5-6,10H2,1-2H3,(H,29,30)/t12-,13+/m1/s1 |
| InChIKey | IPCTWFWLHKOXIV-OLZOCXBDSA-N |
| XLogP | 4.23 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|