C25H20ClN5O3 — CID 172521342
6-chloro-3-[[(1R)-1-[2-cyano-3-(4-methoxyphenyl)-7-methylquinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid (PubChem CID 172521342) has the molecular formula C25H20ClN5O3 and a molecular weight of 473.92 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-[2-cyano-3-(4-methoxyphenyl)-7-methylquinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[[(1R)-1-[2-cyano-3-(4-methoxyphenyl)-7-methylquinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 172521342 |
| Molecular Formula | C25H20ClN5O3 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-[2-cyano-3-(4-methoxyphenyl)-7-methylquinoxalin-5-yl]ethyl]amino]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(-c2nc3c([C@@H](C)Nc4ccc(Cl)nc4C(=O)O)cc(C)cc3nc2C#N)cc1 |
| InChI | InChI=1S/C25H20ClN5O3/c1-13-10-17(14(2)28-18-8-9-21(26)30-24(18)25(32)33)23-19(11-13)29-20(12-27)22(31-23)15-4-6-16(34-3)7-5-15/h4-11,14,28H,1-3H3,(H,32,33)/t14-/m1/s1 |
| InChIKey | LOCFICSIYYGICB-CQSZACIVSA-N |
| XLogP | 5.41 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|