C23H23ClN6O2 — CID 172521135
6-chloro-3-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid (PubChem CID 172521135) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is 6-chloro-3-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 172521135 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 6-chloro-3-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C(=O)O)c2nc(C3CCNCC3)c(C#N)nc2c1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-12-9-15(13(2)27-16-3-4-19(24)29-22(16)23(31)32)21-17(10-12)28-18(11-25)20(30-21)14-5-7-26-8-6-14/h3-4,9-10,13-14,26-27H,5-8H2,1-2H3,(H,31,32)/t13-/m1/s1 |
| InChIKey | RIURADNANFWHHH-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|