About 4-phenylbutanoic acid;tungsten(2+)
4-phenylbutanoic acid;tungsten(2+) (PubChem CID 172532886) has the molecular formula C10H10O2W
and a molecular weight of 346.03 g/mol. Its IUPAC name is 4-phenylbutanoic acid;tungsten(2+).
Molecular Properties
| Compound Name | 4-phenylbutanoic acid;tungsten(2+) |
| PubChem CID | 172532886 |
| Molecular Formula | C10H10O2W |
| Molecular Weight | 346.03 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-phenylbutanoic acid;tungsten(2+) |
| SMILES | O=C(O)[CH-]CCc1[c-]cccc1.[W+2] |
| InChI | InChI=1S/C10H10O2.W/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h1-3,5,8H,4,7H2,(H,11,12);/q-2;+2 |
| InChIKey | CHJFNJFWPRYSKH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.03 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbutanoic acid;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutanoic acid;tungsten(2+)?
The IUPAC name of 4-phenylbutanoic acid;tungsten(2+) (CID 172532886) is 4-phenylbutanoic acid;tungsten(2+).
What is the SMILES notation for 4-phenylbutanoic acid;tungsten(2+)?
The canonical SMILES for 4-phenylbutanoic acid;tungsten(2+) is O=C(O)[CH-]CCc1[c-]cccc1.[W+2].
What is the InChIKey of 4-phenylbutanoic acid;tungsten(2+)?
The InChIKey is CHJFNJFWPRYSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.W/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h1-3,5,8H,4,7H2,(H,11,12);/q-2;+2.
What are the key properties of 4-phenylbutanoic acid;tungsten(2+)?
4-phenylbutanoic acid;tungsten(2+) has a molecular weight of 346.03 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutanoic acid;tungsten(2+) is sourced from PubChem (CID 172532886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).