C19H29NaO4 — CID 174968000
sodium;decylbenzene;propanedioic acid (PubChem CID 174968000) has the molecular formula C19H29NaO4 and a molecular weight of 344.43 g/mol. Its IUPAC name is sodium;decylbenzene;propanedioic acid.
| Compound Name | sodium;decylbenzene;propanedioic acid |
|---|---|
| PubChem CID | 174968000 |
| Molecular Formula | C19H29NaO4 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | sodium;decylbenzene;propanedioic acid |
| SMILES | CCCCCCCCCCc1[c-]cccc1.O=C(O)CC(=O)O.[Na+] |
| InChI | InChI=1S/C16H25.C3H4O4.Na/c1-2-3-4-5-6-7-8-10-13-16-14-11-9-12-15-16;4-2(5)1-3(6)7;/h9,11-12,14H,2-8,10,13H2,1H3;1H2,(H,4,5)(H,6,7);/q-1;;+1 |
| InChIKey | KFUFKZYNXLNXBR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|