About CID 172534883
CID 172534883 (PubChem CID 172534883) has the molecular formula C43H39IrN3OSi2-2
and a molecular weight of 868.23 g/mol.
Molecular Properties
| Compound Name | CID 172534883 |
| PubChem CID | 172534883 |
| Molecular Formula | C43H39IrN3OSi2-2 |
| Molecular Weight | 868.23 g/mol |
| Exact Mass | 868.26 |
| IUPAC Name | — |
| SMILES | C[Si]1(C)CC[Si](C)(C)c2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)ncc21.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir] |
| InChI | InChI=1S/C30H27N2OSi2.C13H12N.Ir/c1-34(2)14-15-35(3,4)30-27(34)18-31-29(32-30)23-11-7-10-22-25-16-20-13-12-19-8-5-6-9-21(19)24(20)17-26(25)33-28(22)23;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h5-10,12-13,16-18H,14-15H2,1-4H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | HFHWBNCAXCCIKT-RUHQGNAASA-N |
| XLogP | 10.16 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 868.23 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 172534883 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172534883?
The IUPAC name of CID 172534883 (CID 172534883) is not available.
What is the SMILES notation for CID 172534883?
The canonical SMILES for CID 172534883 is C[Si]1(C)CC[Si](C)(C)c2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)ncc21.[2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir].
What is the InChIKey of CID 172534883?
The InChIKey is HFHWBNCAXCCIKT-RUHQGNAASA-N. The full InChI is InChI=1S/C30H27N2OSi2.C13H12N.Ir/c1-34(2)14-15-35(3,4)30-27(34)18-31-29(32-30)23-11-7-10-22-25-16-20-13-12-19-8-5-6-9-21(19)24(20)17-26(25)33-28(22)23;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h5-10,12-13,16-18H,14-15H2,1-4H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3;.
What are the key properties of CID 172534883?
CID 172534883 has a molecular weight of 868.23 g/mol, XLogP of 10.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172534883 is sourced from PubChem (CID 172534883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).