C10H22O4S — CID 172538791
2-[2-[2-(1-methoxypropan-2-yloxy)ethoxy]ethoxy]ethanethiol (PubChem CID 172538791) has the molecular formula C10H22O4S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-[2-[2-(1-methoxypropan-2-yloxy)ethoxy]ethoxy]ethanethiol.
| Compound Name | 2-[2-[2-(1-methoxypropan-2-yloxy)ethoxy]ethoxy]ethanethiol |
|---|---|
| PubChem CID | 172538791 |
| Molecular Formula | C10H22O4S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[2-[2-(1-methoxypropan-2-yloxy)ethoxy]ethoxy]ethanethiol |
| SMILES | COCC(C)OCCOCCOCCS |
| InChI | InChI=1S/C10H22O4S/c1-10(9-11-2)14-6-5-12-3-4-13-7-8-15/h10,15H,3-9H2,1-2H3 |
| InChIKey | JSAMANGDRJXMMT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|