C58H104N2O14 — CID 172539191
dioctyl 3-[2-[2-[2-[5-octoxy-3-(2-octoxy-2-oxoethyl)-5-oxopentanoyl]oxyethyl-(2-piperidin-1-ylethoxycarbonyl)amino]ethoxy]-2-oxoethyl]pentanedioate (PubChem CID 172539191) has the molecular formula C58H104N2O14 and a molecular weight of 1053.47 g/mol. Its IUPAC name is dioctyl 3-[2-[2-[2-[5-octoxy-3-(2-octoxy-2-oxoethyl)-5-oxopentanoyl]oxyethyl-(2-piperidin-1-ylethoxycarbonyl)amino]ethoxy]-2-oxoethyl]pentanedioate.
| Compound Name | dioctyl 3-[2-[2-[2-[5-octoxy-3-(2-octoxy-2-oxoethyl)-5-oxopentanoyl]oxyethyl-(2-piperidin-1-ylethoxycarbonyl)amino]ethoxy]-2-oxoethyl]pentanedioate |
|---|---|
| PubChem CID | 172539191 |
| Molecular Formula | C58H104N2O14 |
| Molecular Weight | 1053.47 g/mol |
| Exact Mass | 1052.75 |
| IUPAC Name | dioctyl 3-[2-[2-[2-[5-octoxy-3-(2-octoxy-2-oxoethyl)-5-oxopentanoyl]oxyethyl-(2-piperidin-1-ylethoxycarbonyl)amino]ethoxy]-2-oxoethyl]pentanedioate |
| SMILES | CCCCCCCCOC(=O)CC(CC(=O)OCCCCCCCC)CC(=O)OCCN(CCOC(=O)CC(CC(=O)OCCCCCCCC)CC(=O)OCCCCCCCC)C(=O)OCCN1CCCCC1 |
| InChI | InChI=1S/C58H104N2O14/c1-5-9-13-17-21-28-37-68-52(61)44-50(45-53(62)69-38-29-22-18-14-10-6-2)48-56(65)72-42-35-60(58(67)74-41-34-59-32-26-25-27-33-59)36-43-73-57(66)49-51(46-54(63)70-39-30-23-19-15-11-7-3)47-55(64)71-40-31-24-20-16-12-8-4/h50-51H,5-49H2,1-4H3 |
| InChIKey | FKFDWPIFUWXZMO-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 190.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.47 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|