C24H40N2O3 — CID 10094826
2-piperidin-1-ylethyl N-(2-heptoxyphenyl)-N-propylcarbamate (PubChem CID 10094826) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl N-(2-heptoxyphenyl)-N-propylcarbamate.
| Compound Name | 2-piperidin-1-ylethyl N-(2-heptoxyphenyl)-N-propylcarbamate |
|---|---|
| PubChem CID | 10094826 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | 2-piperidin-1-ylethyl N-(2-heptoxyphenyl)-N-propylcarbamate |
| SMILES | CCCCCCCOc1ccccc1N(CCC)C(=O)OCCN1CCCCC1 |
| InChI | InChI=1S/C24H40N2O3/c1-3-5-6-7-13-20-28-23-15-10-9-14-22(23)26(16-4-2)24(27)29-21-19-25-17-11-8-12-18-25/h9-10,14-15H,3-8,11-13,16-21H2,1-2H3 |
| InChIKey | OVTAQUMMUTXBEO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|