C27H46Cl2N3O3- — CID 20980710
N-[1,3-di(piperidin-1-yl)propyl]-N-(2-heptoxyphenyl)carbamate;dihydrochloride (PubChem CID 20980710) has the molecular formula C27H46Cl2N3O3- and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[1,3-di(piperidin-1-yl)propyl]-N-(2-heptoxyphenyl)carbamate;dihydrochloride.
| Compound Name | N-[1,3-di(piperidin-1-yl)propyl]-N-(2-heptoxyphenyl)carbamate;dihydrochloride |
|---|---|
| PubChem CID | 20980710 |
| Molecular Formula | C27H46Cl2N3O3- |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-[1,3-di(piperidin-1-yl)propyl]-N-(2-heptoxyphenyl)carbamate;dihydrochloride |
| SMILES | CCCCCCCOc1ccccc1N(C(=O)[O-])C(CCN1CCCCC1)N1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C27H45N3O3.2ClH/c1-2-3-4-5-14-23-33-25-16-9-8-15-24(25)30(27(31)32)26(29-20-12-7-13-21-29)17-22-28-18-10-6-11-19-28;;/h8-9,15-16,26H,2-7,10-14,17-23H2,1H3,(H,31,32);2*1H/p-1 |
| InChIKey | WFEAFQYMCCSPTD-UHFFFAOYSA-M |
| XLogP | 5.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|