C24H32N2O3S — CID 172549383
[(3S,10R,13S)-10,13-dimethyl-17-pyrimidin-5-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate (PubChem CID 172549383) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is [(3S,10R,13S)-10,13-dimethyl-17-pyrimidin-5-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate.
| Compound Name | [(3S,10R,13S)-10,13-dimethyl-17-pyrimidin-5-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 172549383 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [(3S,10R,13S)-10,13-dimethyl-17-pyrimidin-5-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
| SMILES | C[C@]12CC[C@H](OS(C)(=O)=O)CC1=CCC1C2CC[C@]2(C)C(c3cncnc3)=CCC12 |
| InChI | InChI=1S/C24H32N2O3S/c1-23-10-8-18(29-30(3,27)28)12-17(23)4-5-19-21-7-6-20(16-13-25-15-26-14-16)24(21,2)11-9-22(19)23/h4,6,13-15,18-19,21-22H,5,7-12H2,1-3H3/t18-,19?,21?,22?,23-,24+/m0/s1 |
| InChIKey | GTXLSHIWUWLWDC-ZBUMQEPMSA-N |
| XLogP | 4.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|