C16H20N2OSi — CID 172553428
3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1H-1,5-naphthyridin-2-one (PubChem CID 172553428) has the molecular formula C16H20N2OSi and a molecular weight of 284.43 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1H-1,5-naphthyridin-2-one.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 172553428 |
| Molecular Formula | C16H20N2OSi |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1H-1,5-naphthyridin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)C#Cc1cc2ncccc2[nH]c1=O |
| InChI | InChI=1S/C16H20N2OSi/c1-16(2,3)20(4,5)10-8-12-11-14-13(18-15(12)19)7-6-9-17-14/h6-7,9,11H,1-5H3,(H,18,19) |
| InChIKey | ZBVHPOGLIVMHAV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|