C20H15F3O — CID 172557197
3-methyl-1-[2-(2-phenylethynyl)-5-(trifluoromethyl)phenyl]but-3-en-1-one (PubChem CID 172557197) has the molecular formula C20H15F3O and a molecular weight of 328.33 g/mol. Its IUPAC name is 3-methyl-1-[2-(2-phenylethynyl)-5-(trifluoromethyl)phenyl]but-3-en-1-one.
| Compound Name | 3-methyl-1-[2-(2-phenylethynyl)-5-(trifluoromethyl)phenyl]but-3-en-1-one |
|---|---|
| PubChem CID | 172557197 |
| Molecular Formula | C20H15F3O |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-methyl-1-[2-(2-phenylethynyl)-5-(trifluoromethyl)phenyl]but-3-en-1-one |
| SMILES | C=C(C)CC(=O)c1cc(C(F)(F)F)ccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C20H15F3O/c1-14(2)12-19(24)18-13-17(20(21,22)23)11-10-16(18)9-8-15-6-4-3-5-7-15/h3-7,10-11,13H,1,12H2,2H3 |
| InChIKey | VQZRLJKLSYGFHI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|