C17H20N2O6 — CID 172557493
tert-butyl 1-(nitromethyl)-3-oxo-1,5,7,8-tetrahydrofuro[3,4-g]isoquinoline-6-carboxylate (PubChem CID 172557493) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is tert-butyl 1-(nitromethyl)-3-oxo-1,5,7,8-tetrahydrofuro[3,4-g]isoquinoline-6-carboxylate.
| Compound Name | tert-butyl 1-(nitromethyl)-3-oxo-1,5,7,8-tetrahydrofuro[3,4-g]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 172557493 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl 1-(nitromethyl)-3-oxo-1,5,7,8-tetrahydrofuro[3,4-g]isoquinoline-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(cc2C1)C(=O)OC3C[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N2O6/c1-17(2,3)25-16(21)18-5-4-10-6-12-13(7-11(10)8-18)15(20)24-14(12)9-19(22)23/h6-7,14H,4-5,8-9H2,1-3H3 |
| InChIKey | BEZGUQNIXMLBIP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|