C14H16ClFN4OSi — CID 172561438
N'-(6-chloro-5-trimethylsilylpyridazin-3-yl)-4-fluorobenzohydrazide (PubChem CID 172561438) has the molecular formula C14H16ClFN4OSi and a molecular weight of 338.85 g/mol. Its IUPAC name is N'-(6-chloro-5-trimethylsilylpyridazin-3-yl)-4-fluorobenzohydrazide.
| Compound Name | N'-(6-chloro-5-trimethylsilylpyridazin-3-yl)-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 172561438 |
| Molecular Formula | C14H16ClFN4OSi |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N'-(6-chloro-5-trimethylsilylpyridazin-3-yl)-4-fluorobenzohydrazide |
| SMILES | C[Si](C)(C)c1cc(NNC(=O)c2ccc(F)cc2)nnc1Cl |
| InChI | InChI=1S/C14H16ClFN4OSi/c1-22(2,3)11-8-12(17-19-13(11)15)18-20-14(21)9-4-6-10(16)7-5-9/h4-8H,1-3H3,(H,17,18)(H,20,21) |
| InChIKey | POBOPBYQXIYFFJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|