C14H11ClF3N3O — CID 2805711
4-chloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide (PubChem CID 2805711) has the molecular formula C14H11ClF3N3O and a molecular weight of 329.71 g/mol. Its IUPAC name is 4-chloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 2805711 |
| Molecular Formula | C14H11ClF3N3O |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-chloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
| SMILES | Cc1cc(C(F)(F)F)cc(NNC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H11ClF3N3O/c1-8-6-10(14(16,17)18)7-12(19-8)20-21-13(22)9-2-4-11(15)5-3-9/h2-7H,1H3,(H,19,20)(H,21,22) |
| InChIKey | ONYCHFACZNULGS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|