C13H10Cl2F3N3O2S — CID 2805713
2,4-dichloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide (PubChem CID 2805713) has the molecular formula C13H10Cl2F3N3O2S and a molecular weight of 400.21 g/mol. Its IUPAC name is 2,4-dichloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide.
| Compound Name | 2,4-dichloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 2805713 |
| Molecular Formula | C13H10Cl2F3N3O2S |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 2,4-dichloro-N'-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]benzenesulfonohydrazide |
| SMILES | Cc1cc(C(F)(F)F)cc(NNS(=O)(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H10Cl2F3N3O2S/c1-7-4-8(13(16,17)18)5-12(19-7)20-21-24(22,23)11-3-2-9(14)6-10(11)15/h2-6,21H,1H3,(H,19,20) |
| InChIKey | DVRUQUIGMXZAQU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|