C13H12FNO2 — CID 172562225
3-[(1E)-buta-1,3-dienyl]-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 172562225) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-[(1E)-buta-1,3-dienyl]-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 3-[(1E)-buta-1,3-dienyl]-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 172562225 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[(1E)-buta-1,3-dienyl]-7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | C=C/C=C/C1COc2ccc(F)cc2C(=O)N1 |
| InChI | InChI=1S/C13H12FNO2/c1-2-3-4-10-8-17-12-6-5-9(14)7-11(12)13(16)15-10/h2-7,10H,1,8H2,(H,15,16)/b4-3+ |
| InChIKey | GPKJZVOEUQCCIA-ONEGZZNKSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|