C26H30F5N5O3 — CID 172563869
N-[3-[[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-methylamino]-5-(4,4-difluorocyclohexyl)-2-pyridinyl]formamide (PubChem CID 172563869) has the molecular formula C26H30F5N5O3 and a molecular weight of 555.55 g/mol. Its IUPAC name is N-[3-[[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-methylamino]-5-(4,4-difluorocyclohexyl)-2-pyridinyl]formamide.
| Compound Name | N-[3-[[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-methylamino]-5-(4,4-difluorocyclohexyl)-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 172563869 |
| Molecular Formula | C26H30F5N5O3 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | N-[3-[[1-[2-amino-4-(trifluoromethoxy)benzoyl]piperidin-4-yl]-methylamino]-5-(4,4-difluorocyclohexyl)-2-pyridinyl]formamide |
| SMILES | CN(c1cc(C2CCC(F)(F)CC2)cnc1NC=O)C1CCN(C(=O)c2ccc(OC(F)(F)F)cc2N)CC1 |
| InChI | InChI=1S/C26H30F5N5O3/c1-35(22-12-17(14-33-23(22)34-15-37)16-4-8-25(27,28)9-5-16)18-6-10-36(11-7-18)24(38)20-3-2-19(13-21(20)32)39-26(29,30)31/h2-3,12-16,18H,4-11,32H2,1H3,(H,33,34,37) |
| InChIKey | JLEFPSQFYRWFSW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|