C22H26F3N5O3 — CID 172563895
[4-[[2-amino-5-(oxolan-3-yl)-3-pyridinyl]amino]piperidin-1-yl]-[2-amino-4-(trifluoromethoxy)phenyl]methanone (PubChem CID 172563895) has the molecular formula C22H26F3N5O3 and a molecular weight of 465.48 g/mol. Its IUPAC name is [4-[[2-amino-5-(oxolan-3-yl)-3-pyridinyl]amino]piperidin-1-yl]-[2-amino-4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-[[2-amino-5-(oxolan-3-yl)-3-pyridinyl]amino]piperidin-1-yl]-[2-amino-4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 172563895 |
| Molecular Formula | C22H26F3N5O3 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | [4-[[2-amino-5-(oxolan-3-yl)-3-pyridinyl]amino]piperidin-1-yl]-[2-amino-4-(trifluoromethoxy)phenyl]methanone |
| SMILES | Nc1cc(OC(F)(F)F)ccc1C(=O)N1CCC(Nc2cc(C3CCOC3)cnc2N)CC1 |
| InChI | InChI=1S/C22H26F3N5O3/c23-22(24,25)33-16-1-2-17(18(26)10-16)21(31)30-6-3-15(4-7-30)29-19-9-14(11-28-20(19)27)13-5-8-32-12-13/h1-2,9-11,13,15,29H,3-8,12,26H2,(H2,27,28) |
| InChIKey | ZRUVIRASQVPXLA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|