C8H11F8N — CID 172565161
3,3,4,4-tetrafluoro-N-(3,3,4,4-tetrafluorobutyl)butan-1-amine (PubChem CID 172565161) has the molecular formula C8H11F8N and a molecular weight of 273.17 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-N-(3,3,4,4-tetrafluorobutyl)butan-1-amine.
| Compound Name | 3,3,4,4-tetrafluoro-N-(3,3,4,4-tetrafluorobutyl)butan-1-amine |
|---|---|
| PubChem CID | 172565161 |
| Molecular Formula | C8H11F8N |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3,3,4,4-tetrafluoro-N-(3,3,4,4-tetrafluorobutyl)butan-1-amine |
| SMILES | FC(F)C(F)(F)CCNCCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F8N/c9-5(10)7(13,14)1-3-17-4-2-8(15,16)6(11)12/h5-6,17H,1-4H2 |
| InChIKey | GHXSEOQKPFGVBE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|