C14H21N — CID 172565349
ethane;(1Z)-3-methyl-1-(2-methylphenyl)buta-1,3-dien-2-amine (PubChem CID 172565349) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;(1Z)-3-methyl-1-(2-methylphenyl)buta-1,3-dien-2-amine.
| Compound Name | ethane;(1Z)-3-methyl-1-(2-methylphenyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 172565349 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;(1Z)-3-methyl-1-(2-methylphenyl)buta-1,3-dien-2-amine |
| SMILES | C=C(C)/C(N)=C/c1ccccc1C.CC |
| InChI | InChI=1S/C12H15N.C2H6/c1-9(2)12(13)8-11-7-5-4-6-10(11)3;1-2/h4-8H,1,13H2,2-3H3;1-2H3/b12-8-; |
| InChIKey | CBDPYJONPLFEQL-JCTPKUEWSA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|