C18H28N2O2 — CID 172566055
(4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one (PubChem CID 172566055) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one.
| Compound Name | (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one |
|---|---|
| PubChem CID | 172566055 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one |
| SMILES | C=C/C(=C\C(=C/C)C(=O)CC)N1CCN(C(=O)CCC)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-5-9-18(22)20-12-10-19(11-13-20)16(7-3)14-15(6-2)17(21)8-4/h6-7,14H,3,5,8-13H2,1-2,4H3/b15-6+,16-14+ |
| InChIKey | ADGSIEIBPNNPFC-DEFAVMNDSA-N |
| XLogP | 2.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|