C25H28F3N7O2 — CID 172568990
(5R)-5-[[5-[(2E)-2-[1-(3-methylphenyl)ethylidene]hydrazinyl]-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl]methyl]-1-(trifluoromethyl)pyrrolidin-2-one (PubChem CID 172568990) has the molecular formula C25H28F3N7O2 and a molecular weight of 515.54 g/mol. Its IUPAC name is (5R)-5-[[5-[(2E)-2-[1-(3-methylphenyl)ethylidene]hydrazinyl]-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl]methyl]-1-(trifluoromethyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-[[5-[(2E)-2-[1-(3-methylphenyl)ethylidene]hydrazinyl]-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl]methyl]-1-(trifluoromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 172568990 |
| Molecular Formula | C25H28F3N7O2 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (5R)-5-[[5-[(2E)-2-[1-(3-methylphenyl)ethylidene]hydrazinyl]-7-morpholin-4-ylimidazo[4,5-b]pyridin-3-yl]methyl]-1-(trifluoromethyl)pyrrolidin-2-one |
| SMILES | C/C(=N\Nc1cc(N2CCOCC2)c2ncn(C[C@H]3CCC(=O)N3C(F)(F)F)c2n1)c1cccc(C)c1 |
| InChI | InChI=1S/C25H28F3N7O2/c1-16-4-3-5-18(12-16)17(2)31-32-21-13-20(33-8-10-37-11-9-33)23-24(30-21)34(15-29-23)14-19-6-7-22(36)35(19)25(26,27)28/h3-5,12-13,15,19H,6-11,14H2,1-2H3,(H,30,32)/b31-17+/t19-/m1/s1 |
| InChIKey | YXAXJKSJEYFGDL-HMNPYCRMSA-N |
| XLogP | 3.92 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|