C23H26F2N6O2 — CID 172569013
3-(cyclopropylmethyl)-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine (PubChem CID 172569013) has the molecular formula C23H26F2N6O2 and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine.
| Compound Name | 3-(cyclopropylmethyl)-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 172569013 |
| Molecular Formula | C23H26F2N6O2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 3-(cyclopropylmethyl)-N-[(E)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-7-morpholin-4-ylimidazo[4,5-b]pyridin-5-amine |
| SMILES | C/C(=N\Nc1cc(N2CCOCC2)c2ncn(CC3CC3)c2n1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C23H26F2N6O2/c1-15(17-3-2-4-18(11-17)33-23(24)25)28-29-20-12-19(30-7-9-32-10-8-30)21-22(27-20)31(14-26-21)13-16-5-6-16/h2-4,11-12,14,16,23H,5-10,13H2,1H3,(H,27,29)/b28-15+ |
| InChIKey | YBGNWGSGBDWIOX-RWPZCVJISA-N |
| XLogP | 4.12 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|